C27H36N2O8 — CID 44598202
[(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-octoxybenzoate (PubChem CID 44598202) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-octoxybenzoate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-octoxybenzoate |
|---|---|
| PubChem CID | 44598202 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@@H]3OC(C)(C)O[C@@H]32)cc1 |
| InChI | InChI=1S/C27H36N2O8/c1-4-5-6-7-8-9-16-33-19-12-10-18(11-13-19)25(31)34-17-20-22-23(37-27(2,3)36-22)24(35-20)29-15-14-21(30)28-26(29)32/h10-15,20,22-24H,4-9,16-17H2,1-3H3,(H,28,30,32)/t20-,22-,23-,24-/m1/s1 |
| InChIKey | KGKZGVSZQKTJEZ-MSNJVRRCSA-N |
| XLogP | 3.55 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|