C12H17N3O5 — CID 15693553
1-[(3aR,4R,6R,6aR)-6-(aminomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione (PubChem CID 15693553) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-(aminomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-(aminomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15693553 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-(aminomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CN)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O5/c1-12(2)19-8-6(5-13)18-10(9(8)20-12)15-4-3-7(16)14-11(15)17/h3-4,6,8-10H,5,13H2,1-2H3,(H,14,16,17)/t6-,8-,9-,10-/m1/s1 |
| InChIKey | YVSGXMATHIIWAN-PEBGCTIMSA-N |
| XLogP | -1.09 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |