C13H17N3O7 — CID 5271662
[(4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl carbamate (PubChem CID 5271662) has the molecular formula C13H17N3O7 and a molecular weight of 327.29 g/mol. Its IUPAC name is [(4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl carbamate.
| Compound Name | [(4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl carbamate |
|---|---|
| PubChem CID | 5271662 |
| Molecular Formula | C13H17N3O7 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [(4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl carbamate |
| SMILES | CC1(C)OC2C(O1)[C@@H](COC(N)=O)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17N3O7/c1-13(2)22-8-6(5-20-11(14)18)21-10(9(8)23-13)16-4-3-7(17)15-12(16)19/h3-4,6,8-10H,5H2,1-2H3,(H2,14,18)(H,15,17,19)/t6-,8?,9?,10-/m1/s1 |
| InChIKey | PSHKQESDGOBINT-UHMNONSZSA-N |
| XLogP | -0.95 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |