C10H13N3O7 — CID 124680568
[(2S,3R,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl carbamate (PubChem CID 124680568) has the molecular formula C10H13N3O7 and a molecular weight of 287.23 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl carbamate.
| Compound Name | [(2S,3R,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 124680568 |
| Molecular Formula | C10H13N3O7 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | [(2S,3R,4R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl carbamate |
| SMILES | NC(=O)OC[C@@H]1O[C@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N3O7/c11-9(17)19-3-4-6(15)7(16)8(20-4)13-2-1-5(14)12-10(13)18/h1-2,4,6-8,15-16H,3H2,(H2,11,17)(H,12,14,18)/t4-,6-,7+,8-/m0/s1 |
| InChIKey | VHJIMUAZUXZDJV-JPCMASIJSA-N |
| XLogP | -2.75 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |