C14H20N2O7 — CID 677806
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 677806) has the molecular formula C14H20N2O7 and a molecular weight of 328.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 677806 |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20N2O7/c1-14(2,3)12(20)22-6-7-9(18)10(19)11(23-7)16-5-4-8(17)15-13(16)21/h4-5,7,9-11,18-19H,6H2,1-3H3,(H,15,17,21)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | CPSCQGGGSGKBEK-QCNRFFRDSA-N |
| XLogP | -1.25 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |