C17H24N2O7 — CID 90975610
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl oct-4-enoate (PubChem CID 90975610) has the molecular formula C17H24N2O7 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl oct-4-enoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl oct-4-enoate |
|---|---|
| PubChem CID | 90975610 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl oct-4-enoate |
| SMILES | CCCC=CCCC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24N2O7/c1-2-3-4-5-6-7-13(21)25-10-11-14(22)15(23)16(26-11)19-9-8-12(20)18-17(19)24/h4-5,8-9,11,14-16,22-23H,2-3,6-7,10H2,1H3,(H,18,20,24)/t11-,14-,15-,16-/m1/s1 |
| InChIKey | AIPYCLOJFGKJCF-RAEVTNRLSA-N |
| XLogP | -0.16 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|