C13H15N3O7 — CID 51354907
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-prop-2-ynylcarbamate (PubChem CID 51354907) has the molecular formula C13H15N3O7 and a molecular weight of 325.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-prop-2-ynylcarbamate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 51354907 |
| Molecular Formula | C13H15N3O7 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-prop-2-ynylcarbamate |
| SMILES | C#CCNC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H15N3O7/c1-2-4-14-13(21)22-6-7-9(18)10(19)11(23-7)16-5-3-8(17)15-12(16)20/h1,3,5,7,9-11,18-19H,4,6H2,(H,14,21)(H,15,17,20)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | AYKYGLUQKHKDHB-QCNRFFRDSA-N |
| XLogP | -2.48 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|