C12H12N2O8 — CID 175061467
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroperoxy-3-hydroxyoxolan-2-yl]methyl prop-2-ynoate (PubChem CID 175061467) has the molecular formula C12H12N2O8 and a molecular weight of 312.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroperoxy-3-hydroxyoxolan-2-yl]methyl prop-2-ynoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroperoxy-3-hydroxyoxolan-2-yl]methyl prop-2-ynoate |
|---|---|
| PubChem CID | 175061467 |
| Molecular Formula | C12H12N2O8 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroperoxy-3-hydroxyoxolan-2-yl]methyl prop-2-ynoate |
| SMILES | C#CC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OO)[C@H]1O |
| InChI | InChI=1S/C12H12N2O8/c1-2-8(16)20-5-6-9(17)10(22-19)11(21-6)14-4-3-7(15)13-12(14)18/h1,3-4,6,9-11,17,19H,5H2,(H,13,15,18)/t6-,9+,10-,11-/m1/s1 |
| InChIKey | OLUHNEGCOSUKAC-PZNDFVKQSA-N |
| XLogP | -2.17 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|