C11H16N2O6S — CID 22899191
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methylsulfanylmethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 22899191) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methylsulfanylmethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methylsulfanylmethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22899191 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(methylsulfanylmethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CSCOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H16N2O6S/c1-20-5-18-4-6-8(15)9(16)10(19-6)13-3-2-7(14)12-11(13)17/h2-3,6,8-10,15-16H,4-5H2,1H3,(H,12,14,17)/t6-,8-,9-,10-/m1/s1 |
| InChIKey | KDLXKLJYPVCMEF-PEBGCTIMSA-N |
| XLogP | -1.51 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|