C30H34N4O18 — CID 169087902
bis[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] butanedioate (PubChem CID 169087902) has the molecular formula C30H34N4O18 and a molecular weight of 738.61 g/mol. Its IUPAC name is bis[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] butanedioate.
| Compound Name | bis[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 169087902 |
| Molecular Formula | C30H34N4O18 |
| Molecular Weight | 738.61 g/mol |
| Exact Mass | 738.19 |
| IUPAC Name | bis[[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] butanedioate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](COC(=O)CCC(=O)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C30H34N4O18/c1-13(35)47-23-17(51-27(25(23)49-15(3)37)33-9-7-19(39)31-29(33)43)11-45-21(41)5-6-22(42)46-12-18-24(48-14(2)36)26(50-16(4)38)28(52-18)34-10-8-20(40)32-30(34)44/h7-10,17-18,23-28H,5-6,11-12H2,1-4H3,(H,31,39,43)(H,32,40,44)/t17-,18-,23-,24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | HEZJTUCKPVPVSO-NIZYQKEJSA-N |
| XLogP | -2.53 |
| TPSA | 285.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.61 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|