C13H16N2O7S — CID 58978842
[(2R,4S,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-sulfanyloxolan-2-yl]methyl acetate (PubChem CID 58978842) has the molecular formula C13H16N2O7S and a molecular weight of 344.35 g/mol. Its IUPAC name is [(2R,4S,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-sulfanyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,4S,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-sulfanyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58978842 |
| Molecular Formula | C13H16N2O7S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [(2R,4S,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-sulfanyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](S)C1OC(C)=O |
| InChI | InChI=1S/C13H16N2O7S/c1-6(16)20-5-8-10(21-7(2)17)11(23)12(22-8)15-4-3-9(18)14-13(15)19/h3-4,8,10-12,23H,5H2,1-2H3,(H,14,18,19)/t8-,10?,11+,12-/m1/s1 |
| InChIKey | XFXJNLDAGVXCDD-LABGDYGKSA-N |
| XLogP | -0.77 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|