C15H19BrN2O7 — CID 13267972
[(2R,3R,4R,5R)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-3-propanoyloxyoxolan-2-yl]methyl propanoate (PubChem CID 13267972) has the molecular formula C15H19BrN2O7 and a molecular weight of 419.23 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-3-propanoyloxyoxolan-2-yl]methyl propanoate.
| Compound Name | [(2R,3R,4R,5R)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-3-propanoyloxyoxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 13267972 |
| Molecular Formula | C15H19BrN2O7 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | [(2R,3R,4R,5R)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-3-propanoyloxyoxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](Br)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C15H19BrN2O7/c1-3-10(20)23-7-8-13(25-11(21)4-2)12(16)14(24-8)18-6-5-9(19)17-15(18)22/h5-6,8,12-14H,3-4,7H2,1-2H3,(H,17,19,22)/t8-,12-,13-,14-/m1/s1 |
| InChIKey | NGLIYDLJNROMLW-HKSFMPNISA-N |
| XLogP | 0.47 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|