C18H21N3O9S2 — CID 95906158
[(2R,3R,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate (PubChem CID 95906158) has the molecular formula C18H21N3O9S2 and a molecular weight of 487.51 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3R,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 95906158 |
| Molecular Formula | C18H21N3O9S2 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | [(2R,3R,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)C[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C18H21N3O9S2/c1-31(24,25)28-11-14-13(30-32(2,26)27)10-16(29-14)21-9-8-15(20-18(21)23)19-17(22)12-6-4-3-5-7-12/h3-9,13-14,16H,10-11H2,1-2H3,(H,19,20,22,23)/t13-,14-,16-/m1/s1 |
| InChIKey | HFBCERYJWAHIRX-IIAWOOMASA-N |
| XLogP | 0.10 |
| TPSA | 159.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|