C24H35N3O5SSi — CID 140914351
N-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 140914351) has the molecular formula C24H35N3O5SSi and a molecular weight of 505.71 g/mol. Its IUPAC name is N-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 140914351 |
| Molecular Formula | C24H35N3O5SSi |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[1-[(2R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CSCOC1C[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H35N3O5SSi/c1-24(2,3)34(5,6)31-15-19-18(30-16-33-4)14-21(32-19)27-13-12-20(26-23(27)29)25-22(28)17-10-8-7-9-11-17/h7-13,18-19,21H,14-16H2,1-6H3,(H,25,26,28,29)/t18?,19-,21-/m1/s1 |
| InChIKey | UPERCFHFRMYXFP-NYKYFDBJSA-N |
| XLogP | 4.51 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|