C12H18N3O8P — CID 170081776
[5-(2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid (PubChem CID 170081776) has the molecular formula C12H18N3O8P and a molecular weight of 363.26 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid |
|---|---|
| PubChem CID | 170081776 |
| Molecular Formula | C12H18N3O8P |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxyoxolan-2-yl]methoxy-N-oxophosphonamidic acid |
| SMILES | CC(C)OC1CC(n2ccc(=O)[nH]c2=O)OC1COP(=O)(O)N=O |
| InChI | InChI=1S/C12H18N3O8P/c1-7(2)22-8-5-11(15-4-3-10(16)13-12(15)17)23-9(8)6-21-24(19,20)14-18/h3-4,7-9,11H,5-6H2,1-2H3,(H,19,20)(H,13,16,17) |
| InChIKey | TWBMMQJAEGJWHH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|