C11H17N2O7P — CID 58319643
[(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl] methyl hydrogen phosphate (PubChem CID 58319643) has the molecular formula C11H17N2O7P and a molecular weight of 320.24 g/mol. Its IUPAC name is [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 58319643 |
| Molecular Formula | C11H17N2O7P |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-ethyloxolan-3-yl] methyl hydrogen phosphate |
| SMILES | CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)CC1OP(=O)(O)OC |
| InChI | InChI=1S/C11H17N2O7P/c1-3-7-8(20-21(16,17)18-2)6-10(19-7)13-5-4-9(14)12-11(13)15/h4-5,7-8,10H,3,6H2,1-2H3,(H,16,17)(H,12,14,15)/t7-,8?,10-/m1/s1 |
| InChIKey | HSTRCYOAZLDNMF-HUWCLSLFSA-N |
| XLogP | 0.37 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|