C9H13N2O7P — CID 123287690
[(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid (PubChem CID 123287690) has the molecular formula C9H13N2O7P and a molecular weight of 292.18 g/mol. Its IUPAC name is [(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid.
| Compound Name | [(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 123287690 |
| Molecular Formula | C9H13N2O7P |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | [(2R,5S)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methylphosphonic acid |
| SMILES | O=c1ccn([C@@H]2CC(O)[C@H](CP(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N2O7P/c12-5-3-8(18-6(5)4-19(15,16)17)11-2-1-7(13)10-9(11)14/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17)/t5?,6-,8-/m0/s1 |
| InChIKey | KEMXQTNKLSZXKS-SXSZQIEUSA-N |
| XLogP | -1.64 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|