C9H14N5O5+ — CID 174696947
diiminoazanium;1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 174696947) has the molecular formula C9H14N5O5+ and a molecular weight of 272.24 g/mol. Its IUPAC name is diiminoazanium;1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | diiminoazanium;1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174696947 |
| Molecular Formula | C9H14N5O5+ |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | diiminoazanium;1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | N=[N+]=N.O=c1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O5.H2N3/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15;1-3-2/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15);1-2H/q;+1/t5-,6+,8+;/m0./s1 |
| InChIKey | NUVQTPDWQAPOCS-OERIEOFYSA-N |
| XLogP | -1.71 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|