C9H14N2O6P2S — CID 162301563
1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy(phosphanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 162301563) has the molecular formula C9H14N2O6P2S and a molecular weight of 340.23 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy(phosphanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy(phosphanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162301563 |
| Molecular Formula | C9H14N2O6P2S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-[[hydroxy(phosphanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](COP(O)(P)=S)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O6P2S/c12-5-3-8(11-2-1-7(13)10-9(11)14)17-6(5)4-16-19(15,18)20/h1-2,5-6,8,12H,3-4,18H2,(H,15,20)(H,10,13,14)/t5-,6+,8+,19?/m0/s1 |
| InChIKey | MWJROZZZLGIPSA-XRAHYEKOSA-N |
| XLogP | -0.71 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|