C13H19N2O9P — CID 5272112
ethyl [[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]formate (PubChem CID 5272112) has the molecular formula C13H19N2O9P and a molecular weight of 378.27 g/mol. Its IUPAC name is ethyl [[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]formate.
| Compound Name | ethyl [[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]formate |
|---|---|
| PubChem CID | 5272112 |
| Molecular Formula | C13H19N2O9P |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | ethyl [[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]formate |
| SMILES | CCOC(=O)P(=O)(OC)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C13H19N2O9P/c1-3-22-13(19)25(20,21-2)23-7-9-8(16)6-11(24-9)15-5-4-10(17)14-12(15)18/h4-5,8-9,11,16H,3,6-7H2,1-2H3,(H,14,17,18)/t8-,9+,11+,25?/m0/s1 |
| InChIKey | ARFOILFYFMIVQZ-MSJVMCAESA-N |
| XLogP | 0.20 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|