C12H19N3O5 — CID 20700893
1-[(2R,4S,5R)-5-(3-aminopropoxymethyl)-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 20700893) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(3-aminopropoxymethyl)-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-(3-aminopropoxymethyl)-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20700893 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(3-aminopropoxymethyl)-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | NCCCOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C12H19N3O5/c13-3-1-5-19-7-9-8(16)6-11(20-9)15-4-2-10(17)14-12(15)18/h2,4,8-9,11,16H,1,3,5-7,13H2,(H,14,17,18)/t8-,9+,11+/m0/s1 |
| InChIKey | OXKYZSCPRVOXHL-IQJOONFLSA-N |
| XLogP | -1.45 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|