C12H14N2O6 — CID 54262621
1-[(2R,4S,5R)-4-hydroxy-5-(prop-1-ynylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54262621) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(prop-1-ynylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(prop-1-ynylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54262621 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(prop-1-ynylperoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC#COOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C12H14N2O6/c1-2-5-18-19-7-9-8(15)6-11(20-9)14-4-3-10(16)13-12(14)17/h3-4,8-9,11,15H,6-7H2,1H3,(H,13,16,17)/t8-,9+,11+/m0/s1 |
| InChIKey | REOPXQHBTLPPMN-IQJOONFLSA-N |
| XLogP | -0.89 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|