C9H14N2O10P2S — CID 24875762
[(2R,3S,5R)-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 24875762) has the molecular formula C9H14N2O10P2S and a molecular weight of 404.23 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 24875762 |
| Molecular Formula | C9H14N2O10P2S |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=S)ccn1[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C9H14N2O10P2S/c12-5-3-8(11-2-1-7(24)10-9(11)13)20-6(5)4-19-23(17,18)21-22(14,15)16/h1-2,5-6,8,12H,3-4H2,(H,17,18)(H,10,13,24)(H2,14,15,16)/t5-,6+,8+/m0/s1 |
| InChIKey | NAXDJVWJYFNVHU-SHYZEUOFSA-N |
| XLogP | -0.22 |
| TPSA | 180.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|