C9H14FN2O13P3S — CID 10207286
[[(2S,3R,4R,5S)-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 10207286) has the molecular formula C9H14FN2O13P3S and a molecular weight of 502.20 g/mol. Its IUPAC name is [[(2S,3R,4R,5S)-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3R,4R,5S)-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10207286 |
| Molecular Formula | C9H14FN2O13P3S |
| Molecular Weight | 502.20 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | [[(2S,3R,4R,5S)-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=S)ccn1[C@H]1O[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C9H14FN2O13P3S/c10-6-4(3-22-27(18,19)25-28(20,21)24-26(15,16)17)23-8(7(6)13)12-2-1-5(29)11-9(12)14/h1-2,4,6-8,13H,3H2,(H,18,19)(H,20,21)(H,11,14,29)(H2,15,16,17)/t4-,6-,7-,8-/m0/s1 |
| InChIKey | PZGMDHLBNOIAHY-PSQAKQOGSA-N |
| XLogP | -0.15 |
| TPSA | 227.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|