C9H15N2O14P3S — CID 87221305
[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 87221305) has the molecular formula C9H15N2O14P3S and a molecular weight of 500.21 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87221305 |
| Molecular Formula | C9H15N2O14P3S |
| Molecular Weight | 500.21 g/mol |
| Exact Mass | 499.95 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-sulfanyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2S)c(=O)[nH]1 |
| InChI | InChI=1S/C9H15N2O14P3S/c12-5-1-2-11(9(14)10-5)8-7(29)6(13)4(23-8)3-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,4,6-8,13,29H,3H2,(H,18,19)(H,20,21)(H,10,12,14)(H2,15,16,17)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | VWYCPQSMOMLXEF-XVFCMESISA-N |
| XLogP | -1.56 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.21 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|