C10H16N3O15P3S — CID 151692357
O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] carbamothioate (PubChem CID 151692357) has the molecular formula C10H16N3O15P3S and a molecular weight of 543.23 g/mol. Its IUPAC name is O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] carbamothioate.
| Compound Name | O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] carbamothioate |
|---|---|
| PubChem CID | 151692357 |
| Molecular Formula | C10H16N3O15P3S |
| Molecular Weight | 543.23 g/mol |
| Exact Mass | 542.95 |
| IUPAC Name | O-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-3-yl] carbamothioate |
| SMILES | NC(=S)O[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N3O15P3S/c11-9(32)26-7-6(15)4(25-8(7)13-2-1-5(14)12-10(13)16)3-24-30(20,21)28-31(22,23)27-29(17,18)19/h1-2,4,6-8,15H,3H2,(H2,11,32)(H,20,21)(H,22,23)(H,12,14,16)(H2,17,18,19)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | RCVNNDXJZWBFRG-XVFCMESISA-N |
| XLogP | -2.23 |
| TPSA | 279.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.23 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|