C21H42N3O15P3 — CID 86638271
N,N-dibutylbutan-1-amine;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 86638271) has the molecular formula C21H42N3O15P3 and a molecular weight of 669.49 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | N,N-dibutylbutan-1-amine;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 86638271 |
| Molecular Formula | C21H42N3O15P3 |
| Molecular Weight | 669.49 g/mol |
| Exact Mass | 669.18 |
| IUPAC Name | N,N-dibutylbutan-1-amine;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCCCN(CCCC)CCCC.O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H27N.C9H15N2O15P3/c1-4-7-10-13(11-8-5-2)12-9-6-3;12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h4-12H2,1-3H3;1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H,10,12,15)(H2,16,17,18)/t;4-,6-,7-,8-/m.1/s1 |
| InChIKey | XDGHSTLYBUGYMA-DYIFJOFMSA-N |
| XLogP | 1.19 |
| TPSA | 267.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|