C9H15N2O13P3S2 — CID 88955414
[[(2R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 88955414) has the molecular formula C9H15N2O13P3S2 and a molecular weight of 516.28 g/mol. Its IUPAC name is [[(2R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 88955414 |
| Molecular Formula | C9H15N2O13P3S2 |
| Molecular Weight | 516.28 g/mol |
| Exact Mass | 515.92 |
| IUPAC Name | [[(2R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(=S)[nH]c2=S)C(O)C1O |
| InChI | InChI=1S/C9H15N2O13P3S2/c12-6-4(3-21-26(17,18)24-27(19,20)23-25(14,15)16)22-8(7(6)13)11-2-1-5(28)10-9(11)29/h1-2,4,6-8,12-13H,3H2,(H,17,18)(H,19,20)(H,10,28,29)(H2,14,15,16)/t4-,6?,7?,8-/m1/s1 |
| InChIKey | MJWGMFHXYQEFHJ-AYZDMWBASA-N |
| XLogP | 0.24 |
| TPSA | 230.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|