C10H16FN2O13P3S2 — CID 122453651
[[(2R,4S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122453651) has the molecular formula C10H16FN2O13P3S2 and a molecular weight of 548.29 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122453651 |
| Molecular Formula | C10H16FN2O13P3S2 |
| Molecular Weight | 548.29 g/mol |
| Exact Mass | 547.93 |
| IUPAC Name | [[(2R,4S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@@]1(CF)O[C@@H](n2ccc(=S)[nH]c2=S)[C@@H](O)C1O |
| InChI | InChI=1S/C10H16FN2O13P3S2/c11-3-10(4-23-28(19,20)26-29(21,22)25-27(16,17)18)7(15)6(14)8(24-10)13-2-1-5(30)12-9(13)31/h1-2,6-8,14-15H,3-4H2,(H,19,20)(H,21,22)(H,12,30,31)(H2,16,17,18)/t6-,7?,8+,10+/m0/s1 |
| InChIKey | IMHALMKSZLUFBO-JIDVSUIFSA-N |
| XLogP | 0.58 |
| TPSA | 230.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|