C11H14FN2O13P3S2 — CID 122449751
[[(2R,3R,5R)-2-ethynyl-5-[5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122449751) has the molecular formula C11H14FN2O13P3S2 and a molecular weight of 558.29 g/mol. Its IUPAC name is [[(2R,3R,5R)-2-ethynyl-5-[5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-2-ethynyl-5-[5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122449751 |
| Molecular Formula | C11H14FN2O13P3S2 |
| Molecular Weight | 558.29 g/mol |
| Exact Mass | 557.91 |
| IUPAC Name | [[(2R,3R,5R)-2-ethynyl-5-[5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2cc(F)c(=S)[nH]c2=S)C(O)[C@H]1O |
| InChI | InChI=1S/C11H14FN2O13P3S2/c1-2-11(4-24-29(20,21)27-30(22,23)26-28(17,18)19)7(16)6(15)9(25-11)14-3-5(12)8(31)13-10(14)32/h1,3,6-7,9,15-16H,4H2,(H,20,21)(H,22,23)(H,13,31,32)(H2,17,18,19)/t6?,7-,9-,11-/m1/s1 |
| InChIKey | MUNSSDWVTPKQAA-IRZXLPFCSA-N |
| XLogP | 0.38 |
| TPSA | 230.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|