C11H14FN2O14P3S — CID 122449749
[[(2R,3R,5R)-2-ethynyl-5-(5-fluoro-2-oxo-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122449749) has the molecular formula C11H14FN2O14P3S and a molecular weight of 542.22 g/mol. Its IUPAC name is [[(2R,3R,5R)-2-ethynyl-5-(5-fluoro-2-oxo-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-2-ethynyl-5-(5-fluoro-2-oxo-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122449749 |
| Molecular Formula | C11H14FN2O14P3S |
| Molecular Weight | 542.22 g/mol |
| Exact Mass | 541.94 |
| IUPAC Name | [[(2R,3R,5R)-2-ethynyl-5-(5-fluoro-2-oxo-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2cc(F)c(=S)[nH]c2=O)C(O)[C@H]1O |
| InChI | InChI=1S/C11H14FN2O14P3S/c1-2-11(4-25-30(21,22)28-31(23,24)27-29(18,19)20)7(16)6(15)9(26-11)14-3-5(12)8(32)13-10(14)17/h1,3,6-7,9,15-16H,4H2,(H,21,22)(H,23,24)(H,13,17,32)(H2,18,19,20)/t6?,7-,9-,11-/m1/s1 |
| InChIKey | HFGIEHHZUZJMGF-IRZXLPFCSA-N |
| XLogP | -0.99 |
| TPSA | 247.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.22 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|