C11H14F2N3O12P3S — CID 139542813
[[(2R)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 139542813) has the molecular formula C11H14F2N3O12P3S and a molecular weight of 543.23 g/mol. Its IUPAC name is [[(2R)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 139542813 |
| Molecular Formula | C11H14F2N3O12P3S |
| Molecular Weight | 543.23 g/mol |
| Exact Mass | 542.95 |
| IUPAC Name | [[(2R)-5-(4-amino-5-fluoro-2-sulfanylidenepyrimidin-1-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(n2cc(F)c(N)nc2=S)C(F)C1O |
| InChI | InChI=1S/C11H14F2N3O12P3S/c1-2-11(4-25-30(21,22)28-31(23,24)27-29(18,19)20)7(17)6(13)9(26-11)16-3-5(12)8(14)15-10(16)32/h1,3,6-7,9,17H,4H2,(H,21,22)(H,23,24)(H2,14,15,32)(H2,18,19,20)/t6?,7?,9?,11-/m1/s1 |
| InChIKey | UNOUBQQDYSOZLM-ISXLPWLRSA-N |
| XLogP | 0.28 |
| TPSA | 233.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|