C11H11F2N3O4 — CID 25050612
4-amino-1-[5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one (PubChem CID 25050612) has the molecular formula C11H11F2N3O4 and a molecular weight of 287.22 g/mol. Its IUPAC name is 4-amino-1-[5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-[5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 25050612 |
| Molecular Formula | C11H11F2N3O4 |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-amino-1-[5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one |
| SMILES | C#CC1(CO)OC(n2cc(F)c(N)nc2=O)C(F)C1O |
| InChI | InChI=1S/C11H11F2N3O4/c1-2-11(4-17)7(18)6(13)9(20-11)16-3-5(12)8(14)15-10(16)19/h1,3,6-7,9,17-18H,4H2,(H2,14,15,19) |
| InChIKey | SDBOBWKSDSMJQE-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|