C11H11F2N3O3S — CID 166116514
4-amino-1-[(2R,3S,4S,5R)-5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione (PubChem CID 166116514) has the molecular formula C11H11F2N3O3S and a molecular weight of 303.29 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4S,5R)-5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione.
| Compound Name | 4-amino-1-[(2R,3S,4S,5R)-5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione |
|---|---|
| PubChem CID | 166116514 |
| Molecular Formula | C11H11F2N3O3S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-amino-1-[(2R,3S,4S,5R)-5-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cc(F)c(N)nc2=S)[C@@H](F)[C@H]1O |
| InChI | InChI=1S/C11H11F2N3O3S/c1-2-11(4-17)7(18)6(13)9(19-11)16-3-5(12)8(14)15-10(16)20/h1,3,6-7,9,17-18H,4H2,(H2,14,15,20)/t6-,7+,9+,11+/m0/s1 |
| InChIKey | NIUMSMGYJQPUGO-NONSRLQASA-N |
| XLogP | -0.07 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|