C11H10F3N3O3S — CID 163975137
4-amino-1-[(2R,4R,5S)-3-ethynyl-3,5-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione (PubChem CID 163975137) has the molecular formula C11H10F3N3O3S and a molecular weight of 321.28 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5S)-3-ethynyl-3,5-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione.
| Compound Name | 4-amino-1-[(2R,4R,5S)-3-ethynyl-3,5-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione |
|---|---|
| PubChem CID | 163975137 |
| Molecular Formula | C11H10F3N3O3S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-amino-1-[(2R,4R,5S)-3-ethynyl-3,5-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione |
| SMILES | C#CC1(F)[C@@H](O)[C@@](F)(CO)O[C@H]1n1cc(F)c(N)nc1=S |
| InChI | InChI=1S/C11H10F3N3O3S/c1-2-10(13)7(19)11(14,4-18)20-8(10)17-3-5(12)6(15)16-9(17)21/h1,3,7-8,18-19H,4H2,(H2,15,16,21)/t7-,8-,10?,11-/m1/s1 |
| InChIKey | STKXPKYRPWBCBO-ZUCSDGAKSA-N |
| XLogP | 0.22 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|