C10H11F4N3O4S — CID 123725885
4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione (PubChem CID 123725885) has the molecular formula C10H11F4N3O4S and a molecular weight of 345.27 g/mol. Its IUPAC name is 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione.
| Compound Name | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione |
|---|---|
| PubChem CID | 123725885 |
| Molecular Formula | C10H11F4N3O4S |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5-fluoropyrimidine-2-thione |
| SMILES | Nc1nc(=S)n(C2OC(CO)C(O)C2(O)C(F)(F)F)cc1F |
| InChI | InChI=1S/C10H11F4N3O4S/c11-3-1-17(8(22)16-6(3)15)7-9(20,10(12,13)14)5(19)4(2-18)21-7/h1,4-5,7,18-20H,2H2,(H2,15,16,22) |
| InChIKey | ISGXWQQGZVPRND-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|