C9H11BrFN3O4 — CID 57309584
4-amino-1-[(2R,3R,4R,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one (PubChem CID 57309584) has the molecular formula C9H11BrFN3O4 and a molecular weight of 324.11 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 57309584 |
| Molecular Formula | C9H11BrFN3O4 |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-3-bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2Br)cc1F |
| InChI | InChI=1S/C9H11BrFN3O4/c10-5-6(16)4(2-15)18-8(5)14-1-3(11)7(12)13-9(14)17/h1,4-6,8,15-16H,2H2,(H2,12,13,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | PXPJWKFPAAIJNQ-UAKXSSHOSA-N |
| XLogP | -1.02 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|