C12H16FN3O6 — CID 57110454
1-[(2R,3S,4R,5R,6R)-3-acetyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-amino-5-fluoropyrimidin-2-one (PubChem CID 57110454) has the molecular formula C12H16FN3O6 and a molecular weight of 317.27 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R,6R)-3-acetyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-amino-5-fluoropyrimidin-2-one.
| Compound Name | 1-[(2R,3S,4R,5R,6R)-3-acetyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-amino-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 57110454 |
| Molecular Formula | C12H16FN3O6 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-[(2R,3S,4R,5R,6R)-3-acetyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-amino-5-fluoropyrimidin-2-one |
| SMILES | CC(=O)[C@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C12H16FN3O6/c1-4(18)7-9(20)8(19)6(3-17)22-11(7)16-2-5(13)10(14)15-12(16)21/h2,6-9,11,17,19-20H,3H2,1H3,(H2,14,15,21)/t6-,7+,8+,9-,11-/m1/s1 |
| InChIKey | UMTMJFLTDLJMCX-KJFVXYAMSA-N |
| XLogP | -2.22 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |