C10H18N3O9P — CID 71239319
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one;phosphoric acid (PubChem CID 71239319) has the molecular formula C10H18N3O9P and a molecular weight of 355.24 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one;phosphoric acid.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one;phosphoric acid |
|---|---|
| PubChem CID | 71239319 |
| Molecular Formula | C10H18N3O9P |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one;phosphoric acid |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)nc1N.O=P(O)(O)O |
| InChI | InChI=1S/C10H15N3O5.H3O4P/c1-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)18-9;1-5(2,3)4/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17);(H3,1,2,3,4)/t5-,6-,7-,9-;/m1./s1 |
| InChIKey | OWGBDGMJNREUKM-OYUVGMAPSA-N |
| XLogP | -3.18 |
| TPSA | 208.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|