C11H17N3O6 — CID 175232169
4-amino-1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylperoxyoxolan-2-yl]-5-methylpyrimidin-2-one (PubChem CID 175232169) has the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylperoxyoxolan-2-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylperoxyoxolan-2-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 175232169 |
| Molecular Formula | C11H17N3O6 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylperoxyoxolan-2-yl]-5-methylpyrimidin-2-one |
| SMILES | COO[C@@H]1[C@@H](O)[C@@H](CO)O[C@H]1n1cc(C)c(N)nc1=O |
| InChI | InChI=1S/C11H17N3O6/c1-5-3-14(11(17)13-9(5)12)10-8(20-18-2)7(16)6(4-15)19-10/h3,6-8,10,15-16H,4H2,1-2H3,(H2,12,13,17)/t6-,7+,8-,10-/m1/s1 |
| InChIKey | NYEGYUUPTJEUMC-IBCQBUCCSA-N |
| XLogP | -1.67 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|