C20H34N4O6 — CID 11026313
2-[(2R,3R,4R,5R)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-N-octylacetamide (PubChem CID 11026313) has the molecular formula C20H34N4O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-N-octylacetamide.
| Compound Name | 2-[(2R,3R,4R,5R)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-N-octylacetamide |
|---|---|
| PubChem CID | 11026313 |
| Molecular Formula | C20H34N4O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[(2R,3R,4R,5R)-2-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cc(C)c(N)nc1=O |
| InChI | InChI=1S/C20H34N4O6/c1-3-4-5-6-7-8-9-22-15(26)12-29-17-16(27)14(11-25)30-19(17)24-10-13(2)18(21)23-20(24)28/h10,14,16-17,19,25,27H,3-9,11-12H2,1-2H3,(H,22,26)(H2,21,23,28)/t14-,16-,17-,19-/m1/s1 |
| InChIKey | GIEOKOQXKRMNGE-KLICCBINSA-N |
| XLogP | 0.25 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|