C15H23N3O7 — CID 150945404
pentyl 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carboxylate (PubChem CID 150945404) has the molecular formula C15H23N3O7 and a molecular weight of 357.36 g/mol. Its IUPAC name is pentyl 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carboxylate.
| Compound Name | pentyl 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 150945404 |
| Molecular Formula | C15H23N3O7 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | pentyl 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidine-5-carboxylate |
| SMILES | CCCCCOC(=O)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C15H23N3O7/c1-2-3-4-5-24-14(22)8-6-18(15(23)17-12(8)16)13-11(21)10(20)9(7-19)25-13/h6,9-11,13,19-21H,2-5,7H2,1H3,(H2,16,17,23)/t9-,10-,11-,13-/m1/s1 |
| InChIKey | LIYDWYWOCFPJII-PRULPYPASA-N |
| XLogP | -1.22 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|