C17H26FN3O7 — CID 142653377
heptyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate (PubChem CID 142653377) has the molecular formula C17H26FN3O7 and a molecular weight of 403.41 g/mol. Its IUPAC name is heptyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | heptyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142653377 |
| Molecular Formula | C17H26FN3O7 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | heptyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C17H26FN3O7/c1-2-3-4-5-6-7-27-17(26)20-14-10(18)8-21(16(25)19-14)15-13(24)12(23)11(9-22)28-15/h8,11-13,15,22-24H,2-7,9H2,1H3,(H,19,20,25,26)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | QYTGHXNGFCCBHJ-RGCMKSIDSA-N |
| XLogP | 0.51 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|