C28H46FN3O6 — CID 46209573
[(Z)-octadec-9-enyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate (PubChem CID 46209573) has the molecular formula C28H46FN3O6 and a molecular weight of 539.69 g/mol. Its IUPAC name is [(Z)-octadec-9-enyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | [(Z)-octadec-9-enyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 46209573 |
| Molecular Formula | C28H46FN3O6 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | [(Z)-octadec-9-enyl] N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C28H46FN3O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-37-28(36)31-25-22(29)20-32(27(35)30-25)26-24(34)23(33)21(2)38-26/h10-11,20-21,23-24,26,33-34H,3-9,12-19H2,1-2H3,(H,30,31,35,36)/b11-10-/t21-,23-,24-,26-/m1/s1 |
| InChIKey | QDANJUWLYXMLEZ-RPJVRGCYSA-N |
| XLogP | 5.61 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|