C13H19N3O5 — CID 70562905
4-amino-5-[(E)-but-2-enyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 70562905) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-amino-5-[(E)-but-2-enyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-[(E)-but-2-enyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 70562905 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-amino-5-[(E)-but-2-enyl]-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C/C=C/Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C13H19N3O5/c1-2-3-4-7-5-16(13(20)15-11(7)14)12-10(19)9(18)8(6-17)21-12/h2-3,5,8-10,12,17-19H,4,6H2,1H3,(H2,14,15,20)/b3-2+/t8-,9-,10+,12-/m1/s1 |
| InChIKey | RYUFYRLIURAJQE-MPHZFXJMSA-N |
| XLogP | -1.44 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|