C6H8BF3O4 — CID 162602817
CID 162602817 (PubChem CID 162602817) has the molecular formula C6H8BF3O4 and a molecular weight of 211.93 g/mol.
| Compound Name | CID 162602817 |
|---|---|
| PubChem CID | 162602817 |
| Molecular Formula | C6H8BF3O4 |
| Molecular Weight | 211.93 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1OC(CO)[C@@H](O)[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C6H8BF3O4/c7-4-5(13,6(8,9)10)3(12)2(1-11)14-4/h2-4,11-13H,1H2/t2?,3-,4-,5-/m1/s1 |
| InChIKey | NWRKXQPVZKBTFN-RYJUONAYSA-N |
| XLogP | -1.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.93 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|