C8H11BO4 — CID 88930633
CID 88930633 (PubChem CID 88930633) has the molecular formula C8H11BO4 and a molecular weight of 181.98 g/mol.
| Compound Name | CID 88930633 |
|---|---|
| PubChem CID | 88930633 |
| Molecular Formula | C8H11BO4 |
| Molecular Weight | 181.98 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](CO)C(O)C1(O)C=C=C |
| InChI | InChI=1S/C8H11BO4/c1-2-3-8(12)6(11)5(4-10)13-7(8)9/h3,5-7,10-12H,1,4H2/t5-,6?,7-,8?/m1/s1 |
| InChIKey | MWFZQOQPJAUCPB-RYVOCIFZSA-N |
| XLogP | -1.69 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.98 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|