C10H15BO4 — CID 123292061
CID 123292061 (PubChem CID 123292061) has the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol.
| Compound Name | CID 123292061 |
|---|---|
| PubChem CID | 123292061 |
| Molecular Formula | C10H15BO4 |
| Molecular Weight | 210.04 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | — |
| SMILES | [B]C1OC(CO)C(O)C1(O)C=C=C(C)C |
| InChI | InChI=1S/C10H15BO4/c1-6(2)3-4-10(14)8(13)7(5-12)15-9(10)11/h4,7-9,12-14H,5H2,1-2H3 |
| InChIKey | YMMFAEXWUJPUBZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.04 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|