C6H10O7 — CID 91393562
(1S,4R,5R,6R)-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-1,2,5,6-tetrol (PubChem CID 91393562) has the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. Its IUPAC name is (1S,4R,5R,6R)-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-1,2,5,6-tetrol.
| Compound Name | (1S,4R,5R,6R)-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-1,2,5,6-tetrol |
|---|---|
| PubChem CID | 91393562 |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (1S,4R,5R,6R)-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptane-1,2,5,6-tetrol |
| SMILES | OC[C@H]1OC(O)[C@]2(O)O[C@]2(O)[C@@H]1O |
| InChI | InChI=1S/C6H10O7/c7-1-2-3(8)5(10)6(11,13-5)4(9)12-2/h2-4,7-11H,1H2/t2-,3-,4?,5-,6+/m1/s1 |
| InChIKey | ZPRKEIDPARGFPF-NPGRKEFMSA-N |
| XLogP | -3.54 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|