C10H18O10 — CID 11529514
(2R,3S,4S,4aR,6S,7R,8R,8aS)-2,6-bis(hydroxymethyl)-2,3,4,6,7,8-hexahydropyrano[3,2-b]pyran-3,4,4a,7,8,8a-hexol (PubChem CID 11529514) has the molecular formula C10H18O10 and a molecular weight of 298.24 g/mol. Its IUPAC name is (2R,3S,4S,4aR,6S,7R,8R,8aS)-2,6-bis(hydroxymethyl)-2,3,4,6,7,8-hexahydropyrano[3,2-b]pyran-3,4,4a,7,8,8a-hexol.
| Compound Name | (2R,3S,4S,4aR,6S,7R,8R,8aS)-2,6-bis(hydroxymethyl)-2,3,4,6,7,8-hexahydropyrano[3,2-b]pyran-3,4,4a,7,8,8a-hexol |
|---|---|
| PubChem CID | 11529514 |
| Molecular Formula | C10H18O10 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (2R,3S,4S,4aR,6S,7R,8R,8aS)-2,6-bis(hydroxymethyl)-2,3,4,6,7,8-hexahydropyrano[3,2-b]pyran-3,4,4a,7,8,8a-hexol |
| SMILES | OC[C@@H]1O[C@]2(O)[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]2(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O10/c11-1-3-5(13)7(15)10(18)9(17,19-3)8(16)6(14)4(2-12)20-10/h3-8,11-18H,1-2H2/t3-,4+,5-,6+,7+,8-,9+,10- |
| InChIKey | HFTMYDMVCZRBCQ-YJEJVTBQSA-N |
| XLogP | -5.41 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |